C26H36N6O5S — CID 66781810
2-[3-[[3-(6-amino-2-butoxy-8-oxo-7H-purin-9-yl)propyl-(3-methylsulfanylpropanoyl)amino]methyl]phenyl]propanoic acid (PubChem CID 66781810) has the molecular formula C26H36N6O5S and a molecular weight of 544.68 g/mol. Its IUPAC name is 2-[3-[[3-(6-amino-2-butoxy-8-oxo-7H-purin-9-yl)propyl-(3-methylsulfanylpropanoyl)amino]methyl]phenyl]propanoic acid.
| Compound Name | 2-[3-[[3-(6-amino-2-butoxy-8-oxo-7H-purin-9-yl)propyl-(3-methylsulfanylpropanoyl)amino]methyl]phenyl]propanoic acid |
|---|---|
| PubChem CID | 66781810 |
| Molecular Formula | C26H36N6O5S |
| Molecular Weight | 544.68 g/mol |
| Exact Mass | 544.25 |
| IUPAC Name | 2-[3-[[3-(6-amino-2-butoxy-8-oxo-7H-purin-9-yl)propyl-(3-methylsulfanylpropanoyl)amino]methyl]phenyl]propanoic acid |
| SMILES | CCCCOc1nc(N)c2[nH]c(=O)n(CCCN(Cc3cccc(C(C)C(=O)O)c3)C(=O)CCSC)c2n1 |
| InChI | InChI=1S/C26H36N6O5S/c1-4-5-13-37-25-29-22(27)21-23(30-25)32(26(36)28-21)12-7-11-31(20(33)10-14-38-3)16-18-8-6-9-19(15-18)17(2)24(34)35/h6,8-9,15,17H,4-5,7,10-14,16H2,1-3H3,(H,28,36)(H,34,35)(H2,27,29,30) |
| InChIKey | SXAYZZMENPTKHN-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 156.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.68 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|