C34H45N7O4 — CID 16719045
2-[3-[[3-(6-amino-2-butoxy-8-oxo-7H-purin-9-yl)propyl-(1-benzylpiperidin-4-yl)amino]methyl]phenyl]propanoic acid (PubChem CID 16719045) has the molecular formula C34H45N7O4 and a molecular weight of 615.78 g/mol. Its IUPAC name is 2-[3-[[3-(6-amino-2-butoxy-8-oxo-7H-purin-9-yl)propyl-(1-benzylpiperidin-4-yl)amino]methyl]phenyl]propanoic acid.
| Compound Name | 2-[3-[[3-(6-amino-2-butoxy-8-oxo-7H-purin-9-yl)propyl-(1-benzylpiperidin-4-yl)amino]methyl]phenyl]propanoic acid |
|---|---|
| PubChem CID | 16719045 |
| Molecular Formula | C34H45N7O4 |
| Molecular Weight | 615.78 g/mol |
| Exact Mass | 615.35 |
| IUPAC Name | 2-[3-[[3-(6-amino-2-butoxy-8-oxo-7H-purin-9-yl)propyl-(1-benzylpiperidin-4-yl)amino]methyl]phenyl]propanoic acid |
| SMILES | CCCCOc1nc(N)c2[nH]c(=O)n(CCCN(Cc3cccc(C(C)C(=O)O)c3)C3CCN(Cc4ccccc4)CC3)c2n1 |
| InChI | InChI=1S/C34H45N7O4/c1-3-4-20-45-33-37-30(35)29-31(38-33)41(34(44)36-29)17-9-16-40(23-26-12-8-13-27(21-26)24(2)32(42)43)28-14-18-39(19-15-28)22-25-10-6-5-7-11-25/h5-8,10-13,21,24,28H,3-4,9,14-20,22-23H2,1-2H3,(H,36,44)(H,42,43)(H2,35,37,38) |
| InChIKey | KHHWCUSRSPWIPY-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 142.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.78 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|