C21H29N7O3 — CID 25172452
6-amino-9-[[3-(1,4-diazepan-1-ylmethyl)phenyl]methyl]-2-(2-methoxyethoxy)-7H-purin-8-one (PubChem CID 25172452) has the molecular formula C21H29N7O3 and a molecular weight of 427.51 g/mol. Its IUPAC name is 6-amino-9-[[3-(1,4-diazepan-1-ylmethyl)phenyl]methyl]-2-(2-methoxyethoxy)-7H-purin-8-one.
| Compound Name | 6-amino-9-[[3-(1,4-diazepan-1-ylmethyl)phenyl]methyl]-2-(2-methoxyethoxy)-7H-purin-8-one |
|---|---|
| PubChem CID | 25172452 |
| Molecular Formula | C21H29N7O3 |
| Molecular Weight | 427.51 g/mol |
| Exact Mass | 427.23 |
| IUPAC Name | 6-amino-9-[[3-(1,4-diazepan-1-ylmethyl)phenyl]methyl]-2-(2-methoxyethoxy)-7H-purin-8-one |
| SMILES | COCCOc1nc(N)c2[nH]c(=O)n(Cc3cccc(CN4CCCNCC4)c3)c2n1 |
| InChI | InChI=1S/C21H29N7O3/c1-30-10-11-31-20-25-18(22)17-19(26-20)28(21(29)24-17)14-16-5-2-4-15(12-16)13-27-8-3-6-23-7-9-27/h2,4-5,12,23H,3,6-11,13-14H2,1H3,(H,24,29)(H2,22,25,26) |
| InChIKey | FJWIESKQXAIWHK-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 123.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.51 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|