C22H29FN6O3 — CID 142784096
6-amino-2-(2-ethoxyethoxy)-9-[[3-[(4-fluoropiperidin-1-yl)methyl]phenyl]methyl]-7H-purin-8-one (PubChem CID 142784096) has the molecular formula C22H29FN6O3 and a molecular weight of 444.51 g/mol. Its IUPAC name is 6-amino-2-(2-ethoxyethoxy)-9-[[3-[(4-fluoropiperidin-1-yl)methyl]phenyl]methyl]-7H-purin-8-one.
| Compound Name | 6-amino-2-(2-ethoxyethoxy)-9-[[3-[(4-fluoropiperidin-1-yl)methyl]phenyl]methyl]-7H-purin-8-one |
|---|---|
| PubChem CID | 142784096 |
| Molecular Formula | C22H29FN6O3 |
| Molecular Weight | 444.51 g/mol |
| Exact Mass | 444.23 |
| IUPAC Name | 6-amino-2-(2-ethoxyethoxy)-9-[[3-[(4-fluoropiperidin-1-yl)methyl]phenyl]methyl]-7H-purin-8-one |
| SMILES | CCOCCOc1nc(N)c2[nH]c(=O)n(Cc3cccc(CN4CCC(F)CC4)c3)c2n1 |
| InChI | InChI=1S/C22H29FN6O3/c1-2-31-10-11-32-21-26-19(24)18-20(27-21)29(22(30)25-18)14-16-5-3-4-15(12-16)13-28-8-6-17(23)7-9-28/h3-5,12,17H,2,6-11,13-14H2,1H3,(H,25,30)(H2,24,26,27) |
| InChIKey | VVVVLTICZRAURA-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 111.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.51 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|