C39H51N9O2 — CID 165101084
6-amino-9-[[4-[[4-(4-aminophenyl)piperidin-1-yl]methyl]phenyl]methyl]-2-butoxy-7H-purin-8-one;4-piperidin-4-ylaniline (PubChem CID 165101084) has the molecular formula C39H51N9O2 and a molecular weight of 677.90 g/mol. Its IUPAC name is 6-amino-9-[[4-[[4-(4-aminophenyl)piperidin-1-yl]methyl]phenyl]methyl]-2-butoxy-7H-purin-8-one;4-piperidin-4-ylaniline.
| Compound Name | 6-amino-9-[[4-[[4-(4-aminophenyl)piperidin-1-yl]methyl]phenyl]methyl]-2-butoxy-7H-purin-8-one;4-piperidin-4-ylaniline |
|---|---|
| PubChem CID | 165101084 |
| Molecular Formula | C39H51N9O2 |
| Molecular Weight | 677.90 g/mol |
| Exact Mass | 677.42 |
| IUPAC Name | 6-amino-9-[[4-[[4-(4-aminophenyl)piperidin-1-yl]methyl]phenyl]methyl]-2-butoxy-7H-purin-8-one;4-piperidin-4-ylaniline |
| SMILES | CCCCOc1nc(N)c2[nH]c(=O)n(Cc3ccc(CN4CCC(c5ccc(N)cc5)CC4)cc3)c2n1.Nc1ccc(C2CCNCC2)cc1 |
| InChI | InChI=1S/C28H35N7O2.C11H16N2/c1-2-3-16-37-27-32-25(30)24-26(33-27)35(28(36)31-24)18-20-6-4-19(5-7-20)17-34-14-12-22(13-15-34)21-8-10-23(29)11-9-21;12-11-3-1-9(2-4-11)10-5-7-13-8-6-10/h4-11,22H,2-3,12-18,29H2,1H3,(H,31,36)(H2,30,32,33);1-4,10,13H,5-8,12H2 |
| InChIKey | YIDXHUQXQGHTIW-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 166.13 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 677.90 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|