C16H23N5O3 — CID 25026355
6-amino-2-(2-cyclopropylethoxy)-9-[2-(oxolan-3-yl)ethyl]-7H-purin-8-one (PubChem CID 25026355) has the molecular formula C16H23N5O3 and a molecular weight of 333.39 g/mol. Its IUPAC name is 6-amino-2-(2-cyclopropylethoxy)-9-[2-(oxolan-3-yl)ethyl]-7H-purin-8-one.
| Compound Name | 6-amino-2-(2-cyclopropylethoxy)-9-[2-(oxolan-3-yl)ethyl]-7H-purin-8-one |
|---|---|
| PubChem CID | 25026355 |
| Molecular Formula | C16H23N5O3 |
| Molecular Weight | 333.39 g/mol |
| Exact Mass | 333.18 |
| IUPAC Name | 6-amino-2-(2-cyclopropylethoxy)-9-[2-(oxolan-3-yl)ethyl]-7H-purin-8-one |
| SMILES | Nc1nc(OCCC2CC2)nc2c1[nH]c(=O)n2CCC1CCOC1 |
| InChI | InChI=1S/C16H23N5O3/c17-13-12-14(20-15(19-13)24-8-5-10-1-2-10)21(16(22)18-12)6-3-11-4-7-23-9-11/h10-11H,1-9H2,(H,18,22)(H2,17,19,20) |
| InChIKey | PMQPINGSUJOWFG-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 108.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.39 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |