C18H25N5O5 — CID 142878316
methyl (3E,5E)-5-[[6-amino-2-(2-methoxyethoxy)-8-oxo-7H-purin-9-yl]methyl]-3-methylhepta-3,5-dienoate (PubChem CID 142878316) has the molecular formula C18H25N5O5 and a molecular weight of 391.43 g/mol. Its IUPAC name is methyl (3E,5E)-5-[[6-amino-2-(2-methoxyethoxy)-8-oxo-7H-purin-9-yl]methyl]-3-methylhepta-3,5-dienoate.
| Compound Name | methyl (3E,5E)-5-[[6-amino-2-(2-methoxyethoxy)-8-oxo-7H-purin-9-yl]methyl]-3-methylhepta-3,5-dienoate |
|---|---|
| PubChem CID | 142878316 |
| Molecular Formula | C18H25N5O5 |
| Molecular Weight | 391.43 g/mol |
| Exact Mass | 391.19 |
| IUPAC Name | methyl (3E,5E)-5-[[6-amino-2-(2-methoxyethoxy)-8-oxo-7H-purin-9-yl]methyl]-3-methylhepta-3,5-dienoate |
| SMILES | C/C=C(\C=C(/C)CC(=O)OC)Cn1c(=O)[nH]c2c(N)nc(OCCOC)nc21 |
| InChI | InChI=1S/C18H25N5O5/c1-5-12(8-11(2)9-13(24)27-4)10-23-16-14(20-18(23)25)15(19)21-17(22-16)28-7-6-26-3/h5,8H,6-7,9-10H2,1-4H3,(H,20,25)(H2,19,21,22)/b11-8+,12-5+ |
| InChIKey | YLLQZYJWMILCLM-OEBNHILSSA-N |
| XLogP | 1.18 |
| TPSA | 134.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.43 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|