C18H28N6O5 — CID 143428558
methyl 2-[7-[(6-amino-2-butoxy-8-oxo-7H-purin-9-yl)methyl]-1,4-oxazepan-4-yl]acetate (PubChem CID 143428558) has the molecular formula C18H28N6O5 and a molecular weight of 408.46 g/mol. Its IUPAC name is methyl 2-[7-[(6-amino-2-butoxy-8-oxo-7H-purin-9-yl)methyl]-1,4-oxazepan-4-yl]acetate.
| Compound Name | methyl 2-[7-[(6-amino-2-butoxy-8-oxo-7H-purin-9-yl)methyl]-1,4-oxazepan-4-yl]acetate |
|---|---|
| PubChem CID | 143428558 |
| Molecular Formula | C18H28N6O5 |
| Molecular Weight | 408.46 g/mol |
| Exact Mass | 408.21 |
| IUPAC Name | methyl 2-[7-[(6-amino-2-butoxy-8-oxo-7H-purin-9-yl)methyl]-1,4-oxazepan-4-yl]acetate |
| SMILES | CCCCOc1nc(N)c2[nH]c(=O)n(CC3CCN(CC(=O)OC)CCO3)c2n1 |
| InChI | InChI=1S/C18H28N6O5/c1-3-4-8-29-17-21-15(19)14-16(22-17)24(18(26)20-14)10-12-5-6-23(7-9-28-12)11-13(25)27-2/h12H,3-11H2,1-2H3,(H,20,26)(H2,19,21,22) |
| InChIKey | QLDHVHGKLLEZGT-UHFFFAOYSA-N |
| XLogP | 0.14 |
| TPSA | 137.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.46 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|