C22H33N7O3 — CID 170741683
6-amino-2-butoxy-9-[[2-methoxy-4-(piperazin-1-ylmethyl)cyclohexa-1,5-dien-1-yl]methyl]-7H-purin-8-one (PubChem CID 170741683) has the molecular formula C22H33N7O3 and a molecular weight of 443.55 g/mol. Its IUPAC name is 6-amino-2-butoxy-9-[[2-methoxy-4-(piperazin-1-ylmethyl)cyclohexa-1,5-dien-1-yl]methyl]-7H-purin-8-one.
| Compound Name | 6-amino-2-butoxy-9-[[2-methoxy-4-(piperazin-1-ylmethyl)cyclohexa-1,5-dien-1-yl]methyl]-7H-purin-8-one |
|---|---|
| PubChem CID | 170741683 |
| Molecular Formula | C22H33N7O3 |
| Molecular Weight | 443.55 g/mol |
| Exact Mass | 443.26 |
| IUPAC Name | 6-amino-2-butoxy-9-[[2-methoxy-4-(piperazin-1-ylmethyl)cyclohexa-1,5-dien-1-yl]methyl]-7H-purin-8-one |
| SMILES | CCCCOc1nc(N)c2[nH]c(=O)n(CC3=C(OC)CC(CN4CCNCC4)C=C3)c2n1 |
| InChI | InChI=1S/C22H33N7O3/c1-3-4-11-32-21-26-19(23)18-20(27-21)29(22(30)25-18)14-16-6-5-15(12-17(16)31-2)13-28-9-7-24-8-10-28/h5-6,15,24H,3-4,7-14H2,1-2H3,(H,25,30)(H2,23,26,27) |
| InChIKey | OHWWVPQEOZFTKG-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 123.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.55 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|