C33H42N8O6 — CID 90352970
tert-butyl (4S)-5-[4-[[6-amino-2-(butylamino)-8-oxo-7H-purin-9-yl]methyl]anilino]-5-oxo-4-(phenylmethoxycarbonylamino)pentanoate (PubChem CID 90352970) has the molecular formula C33H42N8O6 and a molecular weight of 646.75 g/mol. Its IUPAC name is tert-butyl (4S)-5-[4-[[6-amino-2-(butylamino)-8-oxo-7H-purin-9-yl]methyl]anilino]-5-oxo-4-(phenylmethoxycarbonylamino)pentanoate.
| Compound Name | tert-butyl (4S)-5-[4-[[6-amino-2-(butylamino)-8-oxo-7H-purin-9-yl]methyl]anilino]-5-oxo-4-(phenylmethoxycarbonylamino)pentanoate |
|---|---|
| PubChem CID | 90352970 |
| Molecular Formula | C33H42N8O6 |
| Molecular Weight | 646.75 g/mol |
| Exact Mass | 646.32 |
| IUPAC Name | tert-butyl (4S)-5-[4-[[6-amino-2-(butylamino)-8-oxo-7H-purin-9-yl]methyl]anilino]-5-oxo-4-(phenylmethoxycarbonylamino)pentanoate |
| SMILES | CCCCNc1nc(N)c2[nH]c(=O)n(Cc3ccc(NC(=O)[C@H](CCC(=O)OC(C)(C)C)NC(=O)OCc4ccccc4)cc3)c2n1 |
| InChI | InChI=1S/C33H42N8O6/c1-5-6-18-35-30-39-27(34)26-28(40-30)41(31(44)38-26)19-21-12-14-23(15-13-21)36-29(43)24(16-17-25(42)47-33(2,3)4)37-32(45)46-20-22-10-8-7-9-11-22/h7-15,24H,5-6,16-20H2,1-4H3,(H,36,43)(H,37,45)(H,38,44)(H3,34,35,39,40)/t24-/m0/s1 |
| InChIKey | VBRNOLRHVRFQBT-DEOSSOPVSA-N |
| XLogP | 4.32 |
| TPSA | 195.35 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 646.75 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|