C21H28N6O3 — CID 137414059
tert-butyl 4-[[6-amino-2-(butylamino)-8-oxo-7H-purin-9-yl]methyl]benzoate (PubChem CID 137414059) has the molecular formula C21H28N6O3 and a molecular weight of 412.49 g/mol. Its IUPAC name is tert-butyl 4-[[6-amino-2-(butylamino)-8-oxo-7H-purin-9-yl]methyl]benzoate.
| Compound Name | tert-butyl 4-[[6-amino-2-(butylamino)-8-oxo-7H-purin-9-yl]methyl]benzoate |
|---|---|
| PubChem CID | 137414059 |
| Molecular Formula | C21H28N6O3 |
| Molecular Weight | 412.49 g/mol |
| Exact Mass | 412.22 |
| IUPAC Name | tert-butyl 4-[[6-amino-2-(butylamino)-8-oxo-7H-purin-9-yl]methyl]benzoate |
| SMILES | CCCCNc1nc(N)c2[nH]c(=O)n(Cc3ccc(C(=O)OC(C)(C)C)cc3)c2n1 |
| InChI | InChI=1S/C21H28N6O3/c1-5-6-11-23-19-25-16(22)15-17(26-19)27(20(29)24-15)12-13-7-9-14(10-8-13)18(28)30-21(2,3)4/h7-10H,5-6,11-12H2,1-4H3,(H,24,29)(H3,22,23,25,26) |
| InChIKey | MHGJIXYQIHSLNT-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 127.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.49 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|