C18H24N6O — CID 126630337
6-amino-2-(butylamino)-9-[(4-ethylphenyl)methyl]-7H-purin-8-one (PubChem CID 126630337) has the molecular formula C18H24N6O and a molecular weight of 340.43 g/mol. Its IUPAC name is 6-amino-2-(butylamino)-9-[(4-ethylphenyl)methyl]-7H-purin-8-one.
| Compound Name | 6-amino-2-(butylamino)-9-[(4-ethylphenyl)methyl]-7H-purin-8-one |
|---|---|
| PubChem CID | 126630337 |
| Molecular Formula | C18H24N6O |
| Molecular Weight | 340.43 g/mol |
| Exact Mass | 340.20 |
| IUPAC Name | 6-amino-2-(butylamino)-9-[(4-ethylphenyl)methyl]-7H-purin-8-one |
| SMILES | CCCCNc1nc(N)c2[nH]c(=O)n(Cc3ccc(CC)cc3)c2n1 |
| InChI | InChI=1S/C18H24N6O/c1-3-5-10-20-17-22-15(19)14-16(23-17)24(18(25)21-14)11-13-8-6-12(4-2)7-9-13/h6-9H,3-5,10-11H2,1-2H3,(H,21,25)(H3,19,20,22,23) |
| InChIKey | FCFIEOWWGGXEHL-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 101.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.43 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|