C21H31N9O — CID 25070830
6-amino-2-(butylamino)-9-[[6-[3-(dimethylamino)pyrrolidin-1-yl]-3-pyridinyl]methyl]-7H-purin-8-one (PubChem CID 25070830) has the molecular formula C21H31N9O and a molecular weight of 425.54 g/mol. Its IUPAC name is 6-amino-2-(butylamino)-9-[[6-[3-(dimethylamino)pyrrolidin-1-yl]-3-pyridinyl]methyl]-7H-purin-8-one.
| Compound Name | 6-amino-2-(butylamino)-9-[[6-[3-(dimethylamino)pyrrolidin-1-yl]-3-pyridinyl]methyl]-7H-purin-8-one |
|---|---|
| PubChem CID | 25070830 |
| Molecular Formula | C21H31N9O |
| Molecular Weight | 425.54 g/mol |
| Exact Mass | 425.27 |
| IUPAC Name | 6-amino-2-(butylamino)-9-[[6-[3-(dimethylamino)pyrrolidin-1-yl]-3-pyridinyl]methyl]-7H-purin-8-one |
| SMILES | CCCCNc1nc(N)c2[nH]c(=O)n(Cc3ccc(N4CCC(N(C)C)C4)nc3)c2n1 |
| InChI | InChI=1S/C21H31N9O/c1-4-5-9-23-20-26-18(22)17-19(27-20)30(21(31)25-17)12-14-6-7-16(24-11-14)29-10-8-15(13-29)28(2)3/h6-7,11,15H,4-5,8-10,12-13H2,1-3H3,(H,25,31)(H3,22,23,26,27) |
| InChIKey | CBHXWFSOBALHGF-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 120.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.54 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|