C20H36N8O — CID 67224926
6-amino-2-(butylamino)-9-[4-(4-propan-2-ylpiperazin-1-yl)butyl]-7H-purin-8-one (PubChem CID 67224926) has the molecular formula C20H36N8O and a molecular weight of 404.56 g/mol. Its IUPAC name is 6-amino-2-(butylamino)-9-[4-(4-propan-2-ylpiperazin-1-yl)butyl]-7H-purin-8-one.
| Compound Name | 6-amino-2-(butylamino)-9-[4-(4-propan-2-ylpiperazin-1-yl)butyl]-7H-purin-8-one |
|---|---|
| PubChem CID | 67224926 |
| Molecular Formula | C20H36N8O |
| Molecular Weight | 404.56 g/mol |
| Exact Mass | 404.30 |
| IUPAC Name | 6-amino-2-(butylamino)-9-[4-(4-propan-2-ylpiperazin-1-yl)butyl]-7H-purin-8-one |
| SMILES | CCCCNc1nc(N)c2[nH]c(=O)n(CCCCN3CCN(C(C)C)CC3)c2n1 |
| InChI | InChI=1S/C20H36N8O/c1-4-5-8-22-19-24-17(21)16-18(25-19)28(20(29)23-16)10-7-6-9-26-11-13-27(14-12-26)15(2)3/h15H,4-14H2,1-3H3,(H,23,29)(H3,21,22,24,25) |
| InChIKey | UYIVBIIGQPWDRV-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 108.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.56 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|