C17H29N7O2 — CID 67224012
6-amino-2-(butylamino)-9-[3-(oxolan-2-ylmethylamino)propyl]-7H-purin-8-one (PubChem CID 67224012) has the molecular formula C17H29N7O2 and a molecular weight of 363.47 g/mol. Its IUPAC name is 6-amino-2-(butylamino)-9-[3-(oxolan-2-ylmethylamino)propyl]-7H-purin-8-one.
| Compound Name | 6-amino-2-(butylamino)-9-[3-(oxolan-2-ylmethylamino)propyl]-7H-purin-8-one |
|---|---|
| PubChem CID | 67224012 |
| Molecular Formula | C17H29N7O2 |
| Molecular Weight | 363.47 g/mol |
| Exact Mass | 363.24 |
| IUPAC Name | 6-amino-2-(butylamino)-9-[3-(oxolan-2-ylmethylamino)propyl]-7H-purin-8-one |
| SMILES | CCCCNc1nc(N)c2[nH]c(=O)n(CCCNCC3CCCO3)c2n1 |
| InChI | InChI=1S/C17H29N7O2/c1-2-3-8-20-16-22-14(18)13-15(23-16)24(17(25)21-13)9-5-7-19-11-12-6-4-10-26-12/h12,19H,2-11H2,1H3,(H,21,25)(H3,18,20,22,23) |
| InChIKey | JQRSVNWPLNOMAD-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 122.88 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.47 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|