C18H31N7O2 — CID 67211919
2-N-butyl-8-methoxy-9-[3-(oxolan-2-ylmethylamino)propyl]purine-2,6-diamine (PubChem CID 67211919) has the molecular formula C18H31N7O2 and a molecular weight of 377.49 g/mol. Its IUPAC name is 2-N-butyl-8-methoxy-9-[3-(oxolan-2-ylmethylamino)propyl]purine-2,6-diamine.
| Compound Name | 2-N-butyl-8-methoxy-9-[3-(oxolan-2-ylmethylamino)propyl]purine-2,6-diamine |
|---|---|
| PubChem CID | 67211919 |
| Molecular Formula | C18H31N7O2 |
| Molecular Weight | 377.49 g/mol |
| Exact Mass | 377.25 |
| IUPAC Name | 2-N-butyl-8-methoxy-9-[3-(oxolan-2-ylmethylamino)propyl]purine-2,6-diamine |
| SMILES | CCCCNc1nc(N)c2nc(OC)n(CCCNCC3CCCO3)c2n1 |
| InChI | InChI=1S/C18H31N7O2/c1-3-4-9-21-17-23-15(19)14-16(24-17)25(18(22-14)26-2)10-6-8-20-12-13-7-5-11-27-13/h13,20H,3-12H2,1-2H3,(H3,19,21,23,24) |
| InChIKey | WOCNMWSZYFSRJH-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 112.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.49 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|