C23H41N7O — CID 91403184
2-N-butyl-9-[7-[ethyl(propyl)amino]-5-methylhept-4-enyl]-8-methoxypurine-2,6-diamine (PubChem CID 91403184) has the molecular formula C23H41N7O and a molecular weight of 431.63 g/mol. Its IUPAC name is 2-N-butyl-9-[7-[ethyl(propyl)amino]-5-methylhept-4-enyl]-8-methoxypurine-2,6-diamine.
| Compound Name | 2-N-butyl-9-[7-[ethyl(propyl)amino]-5-methylhept-4-enyl]-8-methoxypurine-2,6-diamine |
|---|---|
| PubChem CID | 91403184 |
| Molecular Formula | C23H41N7O |
| Molecular Weight | 431.63 g/mol |
| Exact Mass | 431.34 |
| IUPAC Name | 2-N-butyl-9-[7-[ethyl(propyl)amino]-5-methylhept-4-enyl]-8-methoxypurine-2,6-diamine |
| SMILES | CCCCNc1nc(N)c2nc(OC)n(CCCC=C(C)CCN(CC)CCC)c2n1 |
| InChI | InChI=1S/C23H41N7O/c1-6-9-14-25-22-27-20(24)19-21(28-22)30(23(26-19)31-5)16-11-10-12-18(4)13-17-29(8-3)15-7-2/h12H,6-11,13-17H2,1-5H3,(H3,24,25,27,28) |
| InChIKey | DZKHNUZOHSLWBB-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 94.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.63 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|