C19H33N7O2 — CID 67211731
2-N-butyl-8-methoxy-9-[3-[2-(oxolan-2-yl)ethylamino]propyl]purine-2,6-diamine (PubChem CID 67211731) has the molecular formula C19H33N7O2 and a molecular weight of 391.52 g/mol. Its IUPAC name is 2-N-butyl-8-methoxy-9-[3-[2-(oxolan-2-yl)ethylamino]propyl]purine-2,6-diamine.
| Compound Name | 2-N-butyl-8-methoxy-9-[3-[2-(oxolan-2-yl)ethylamino]propyl]purine-2,6-diamine |
|---|---|
| PubChem CID | 67211731 |
| Molecular Formula | C19H33N7O2 |
| Molecular Weight | 391.52 g/mol |
| Exact Mass | 391.27 |
| IUPAC Name | 2-N-butyl-8-methoxy-9-[3-[2-(oxolan-2-yl)ethylamino]propyl]purine-2,6-diamine |
| SMILES | CCCCNc1nc(N)c2nc(OC)n(CCCNCCC3CCCO3)c2n1 |
| InChI | InChI=1S/C19H33N7O2/c1-3-4-10-22-18-24-16(20)15-17(25-18)26(19(23-15)27-2)12-6-9-21-11-8-14-7-5-13-28-14/h14,21H,3-13H2,1-2H3,(H3,20,22,24,25) |
| InChIKey | AOWMLPLMYDPKPO-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 112.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.52 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|