C19H32N6O3 — CID 67211502
8-methoxy-9-[3-(oxolan-2-ylmethylamino)propyl]-2-[(2S)-pentan-2-yl]oxypurin-6-amine (PubChem CID 67211502) has the molecular formula C19H32N6O3 and a molecular weight of 392.50 g/mol. Its IUPAC name is 8-methoxy-9-[3-(oxolan-2-ylmethylamino)propyl]-2-[(2S)-pentan-2-yl]oxypurin-6-amine.
| Compound Name | 8-methoxy-9-[3-(oxolan-2-ylmethylamino)propyl]-2-[(2S)-pentan-2-yl]oxypurin-6-amine |
|---|---|
| PubChem CID | 67211502 |
| Molecular Formula | C19H32N6O3 |
| Molecular Weight | 392.50 g/mol |
| Exact Mass | 392.25 |
| IUPAC Name | 8-methoxy-9-[3-(oxolan-2-ylmethylamino)propyl]-2-[(2S)-pentan-2-yl]oxypurin-6-amine |
| SMILES | CCC[C@H](C)Oc1nc(N)c2nc(OC)n(CCCNCC3CCCO3)c2n1 |
| InChI | InChI=1S/C19H32N6O3/c1-4-7-13(2)28-18-23-16(20)15-17(24-18)25(19(22-15)26-3)10-6-9-21-12-14-8-5-11-27-14/h13-14,21H,4-12H2,1-3H3,(H2,20,23,24)/t13-,14?/m0/s1 |
| InChIKey | RJMLWJUJDUHXQH-LSLKUGRBSA-N |
| XLogP | 2.14 |
| TPSA | 109.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.50 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|