C20H34N6O3 — CID 77241502
8-methoxy-9-[3-[2-(oxolan-2-yl)ethylamino]propyl]-2-pentan-2-yloxypurin-6-amine (PubChem CID 77241502) has the molecular formula C20H34N6O3 and a molecular weight of 406.53 g/mol. Its IUPAC name is 8-methoxy-9-[3-[2-(oxolan-2-yl)ethylamino]propyl]-2-pentan-2-yloxypurin-6-amine.
| Compound Name | 8-methoxy-9-[3-[2-(oxolan-2-yl)ethylamino]propyl]-2-pentan-2-yloxypurin-6-amine |
|---|---|
| PubChem CID | 77241502 |
| Molecular Formula | C20H34N6O3 |
| Molecular Weight | 406.53 g/mol |
| Exact Mass | 406.27 |
| IUPAC Name | 8-methoxy-9-[3-[2-(oxolan-2-yl)ethylamino]propyl]-2-pentan-2-yloxypurin-6-amine |
| SMILES | CCCC(C)Oc1nc(N)c2nc(OC)n(CCCNCCC3CCCO3)c2n1 |
| InChI | InChI=1S/C20H34N6O3/c1-4-7-14(2)29-19-24-17(21)16-18(25-19)26(20(23-16)27-3)12-6-10-22-11-9-15-8-5-13-28-15/h14-15,22H,4-13H2,1-3H3,(H2,21,24,25) |
| InChIKey | JDKDIVLOKMYLDI-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 109.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.53 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|