C23H39N7O2 — CID 67183904
2-cyclohexyloxy-8-methoxy-9-[4-(4-propan-2-ylpiperazin-1-yl)butyl]purin-6-amine (PubChem CID 67183904) has the molecular formula C23H39N7O2 and a molecular weight of 445.61 g/mol. Its IUPAC name is 2-cyclohexyloxy-8-methoxy-9-[4-(4-propan-2-ylpiperazin-1-yl)butyl]purin-6-amine.
| Compound Name | 2-cyclohexyloxy-8-methoxy-9-[4-(4-propan-2-ylpiperazin-1-yl)butyl]purin-6-amine |
|---|---|
| PubChem CID | 67183904 |
| Molecular Formula | C23H39N7O2 |
| Molecular Weight | 445.61 g/mol |
| Exact Mass | 445.32 |
| IUPAC Name | 2-cyclohexyloxy-8-methoxy-9-[4-(4-propan-2-ylpiperazin-1-yl)butyl]purin-6-amine |
| SMILES | COc1nc2c(N)nc(OC3CCCCC3)nc2n1CCCCN1CCN(C(C)C)CC1 |
| InChI | InChI=1S/C23H39N7O2/c1-17(2)29-15-13-28(14-16-29)11-7-8-12-30-21-19(25-23(30)31-3)20(24)26-22(27-21)32-18-9-5-4-6-10-18/h17-18H,4-16H2,1-3H3,(H2,24,26,27) |
| InChIKey | PHIMWRKFWOYQMO-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 94.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.61 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|