C17H23N8O2P — CID 170722632
6-amino-9-[[6-(3-aminopyrrolidin-1-yl)-3-pyridinyl]methyl]-2-dimethylphosphoryl-7H-purin-8-one (PubChem CID 170722632) has the molecular formula C17H23N8O2P and a molecular weight of 402.40 g/mol. Its IUPAC name is 6-amino-9-[[6-(3-aminopyrrolidin-1-yl)-3-pyridinyl]methyl]-2-dimethylphosphoryl-7H-purin-8-one.
| Compound Name | 6-amino-9-[[6-(3-aminopyrrolidin-1-yl)-3-pyridinyl]methyl]-2-dimethylphosphoryl-7H-purin-8-one |
|---|---|
| PubChem CID | 170722632 |
| Molecular Formula | C17H23N8O2P |
| Molecular Weight | 402.40 g/mol |
| Exact Mass | 402.17 |
| IUPAC Name | 6-amino-9-[[6-(3-aminopyrrolidin-1-yl)-3-pyridinyl]methyl]-2-dimethylphosphoryl-7H-purin-8-one |
| SMILES | CP(C)(=O)c1nc(N)c2[nH]c(=O)n(Cc3ccc(N4CCC(N)C4)nc3)c2n1 |
| InChI | InChI=1S/C17H23N8O2P/c1-28(2,27)16-22-14(19)13-15(23-16)25(17(26)21-13)8-10-3-4-12(20-7-10)24-6-5-11(18)9-24/h3-4,7,11H,5-6,8-9,18H2,1-2H3,(H,21,26)(H2,19,22,23) |
| InChIKey | MRKBVLNXZQDFIE-UHFFFAOYSA-N |
| XLogP | -0.07 |
| TPSA | 148.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.40 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|