C19H27N8O2P — CID 170722603
6-amino-2-dimethylphosphoryl-9-[[6-(2-pyrrolidin-1-ylethylamino)-3-pyridinyl]methyl]-7H-purin-8-one (PubChem CID 170722603) has the molecular formula C19H27N8O2P and a molecular weight of 430.45 g/mol. Its IUPAC name is 6-amino-2-dimethylphosphoryl-9-[[6-(2-pyrrolidin-1-ylethylamino)-3-pyridinyl]methyl]-7H-purin-8-one.
| Compound Name | 6-amino-2-dimethylphosphoryl-9-[[6-(2-pyrrolidin-1-ylethylamino)-3-pyridinyl]methyl]-7H-purin-8-one |
|---|---|
| PubChem CID | 170722603 |
| Molecular Formula | C19H27N8O2P |
| Molecular Weight | 430.45 g/mol |
| Exact Mass | 430.20 |
| IUPAC Name | 6-amino-2-dimethylphosphoryl-9-[[6-(2-pyrrolidin-1-ylethylamino)-3-pyridinyl]methyl]-7H-purin-8-one |
| SMILES | CP(C)(=O)c1nc(N)c2[nH]c(=O)n(Cc3ccc(NCCN4CCCC4)nc3)c2n1 |
| InChI | InChI=1S/C19H27N8O2P/c1-30(2,29)18-24-16(20)15-17(25-18)27(19(28)23-15)12-13-5-6-14(22-11-13)21-7-10-26-8-3-4-9-26/h5-6,11H,3-4,7-10,12H2,1-2H3,(H,21,22)(H,23,28)(H2,20,24,25) |
| InChIKey | AYXWQTRHEXUBCL-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 134.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.45 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|