C20H26N6O3S — CID 175036107
6-amino-9-[(4-methoxyphenyl)methyl]-2-(3-pyrrolidin-1-ylpropylsulfanyloxy)-7H-purin-8-one (PubChem CID 175036107) has the molecular formula C20H26N6O3S and a molecular weight of 430.53 g/mol. Its IUPAC name is 6-amino-9-[(4-methoxyphenyl)methyl]-2-(3-pyrrolidin-1-ylpropylsulfanyloxy)-7H-purin-8-one.
| Compound Name | 6-amino-9-[(4-methoxyphenyl)methyl]-2-(3-pyrrolidin-1-ylpropylsulfanyloxy)-7H-purin-8-one |
|---|---|
| PubChem CID | 175036107 |
| Molecular Formula | C20H26N6O3S |
| Molecular Weight | 430.53 g/mol |
| Exact Mass | 430.18 |
| IUPAC Name | 6-amino-9-[(4-methoxyphenyl)methyl]-2-(3-pyrrolidin-1-ylpropylsulfanyloxy)-7H-purin-8-one |
| SMILES | COc1ccc(Cn2c(=O)[nH]c3c(N)nc(OSCCCN4CCCC4)nc32)cc1 |
| InChI | InChI=1S/C20H26N6O3S/c1-28-15-7-5-14(6-8-15)13-26-18-16(22-20(26)27)17(21)23-19(24-18)29-30-12-4-11-25-9-2-3-10-25/h5-8H,2-4,9-13H2,1H3,(H,22,27)(H2,21,23,24) |
| InChIKey | CRZKAVNBTRKHJN-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 111.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.53 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|