C11H10ClN7O — CID 174423329
2,6-diamino-9-[(6-chloro-3-pyridinyl)methyl]-7H-purin-8-one (PubChem CID 174423329) has the molecular formula C11H10ClN7O and a molecular weight of 291.70 g/mol. Its IUPAC name is 2,6-diamino-9-[(6-chloro-3-pyridinyl)methyl]-7H-purin-8-one.
| Compound Name | 2,6-diamino-9-[(6-chloro-3-pyridinyl)methyl]-7H-purin-8-one |
|---|---|
| PubChem CID | 174423329 |
| Molecular Formula | C11H10ClN7O |
| Molecular Weight | 291.70 g/mol |
| Exact Mass | 291.06 |
| IUPAC Name | 2,6-diamino-9-[(6-chloro-3-pyridinyl)methyl]-7H-purin-8-one |
| SMILES | Nc1nc(N)c2[nH]c(=O)n(Cc3ccc(Cl)nc3)c2n1 |
| InChI | InChI=1S/C11H10ClN7O/c12-6-2-1-5(3-15-6)4-19-9-7(16-11(19)20)8(13)17-10(14)18-9/h1-3H,4H2,(H,16,20)(H4,13,14,17,18) |
| InChIKey | OPXGCCUPFRGSMQ-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 128.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.70 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|