C15H15ClFN5OS — CID 134469223
6-amino-2-(3-chloropropylsulfanyl)-9-[(4-fluorophenyl)methyl]-7H-purin-8-one (PubChem CID 134469223) has the molecular formula C15H15ClFN5OS and a molecular weight of 367.84 g/mol. Its IUPAC name is 6-amino-2-(3-chloropropylsulfanyl)-9-[(4-fluorophenyl)methyl]-7H-purin-8-one.
| Compound Name | 6-amino-2-(3-chloropropylsulfanyl)-9-[(4-fluorophenyl)methyl]-7H-purin-8-one |
|---|---|
| PubChem CID | 134469223 |
| Molecular Formula | C15H15ClFN5OS |
| Molecular Weight | 367.84 g/mol |
| Exact Mass | 367.07 |
| IUPAC Name | 6-amino-2-(3-chloropropylsulfanyl)-9-[(4-fluorophenyl)methyl]-7H-purin-8-one |
| SMILES | Nc1nc(SCCCCl)nc2c1[nH]c(=O)n2Cc1ccc(F)cc1 |
| InChI | InChI=1S/C15H15ClFN5OS/c16-6-1-7-24-14-20-12(18)11-13(21-14)22(15(23)19-11)8-9-2-4-10(17)5-3-9/h2-5H,1,6-8H2,(H,19,23)(H2,18,20,21) |
| InChIKey | CFQXAHUXQOKRFM-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 89.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.84 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|