C20H17N5O3S — CID 59382593
3-[(6-amino-9-benzyl-8-oxo-7H-purin-2-yl)sulfanylmethyl]benzoic acid (PubChem CID 59382593) has the molecular formula C20H17N5O3S and a molecular weight of 407.46 g/mol. Its IUPAC name is 3-[(6-amino-9-benzyl-8-oxo-7H-purin-2-yl)sulfanylmethyl]benzoic acid.
| Compound Name | 3-[(6-amino-9-benzyl-8-oxo-7H-purin-2-yl)sulfanylmethyl]benzoic acid |
|---|---|
| PubChem CID | 59382593 |
| Molecular Formula | C20H17N5O3S |
| Molecular Weight | 407.46 g/mol |
| Exact Mass | 407.11 |
| IUPAC Name | 3-[(6-amino-9-benzyl-8-oxo-7H-purin-2-yl)sulfanylmethyl]benzoic acid |
| SMILES | Nc1nc(SCc2cccc(C(=O)O)c2)nc2c1[nH]c(=O)n2Cc1ccccc1 |
| InChI | InChI=1S/C20H17N5O3S/c21-16-15-17(25(20(28)22-15)10-12-5-2-1-3-6-12)24-19(23-16)29-11-13-7-4-8-14(9-13)18(26)27/h1-9H,10-11H2,(H,22,28)(H,26,27)(H2,21,23,24) |
| InChIKey | RHVJVEIWOQWLFN-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 126.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.46 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |