C20H17N5O2S — CID 25269044
4-amino-8-benzyl-2-benzylsulfanyl-5H-pteridine-6,7-dione (PubChem CID 25269044) has the molecular formula C20H17N5O2S and a molecular weight of 391.46 g/mol. Its IUPAC name is 4-amino-8-benzyl-2-benzylsulfanyl-5H-pteridine-6,7-dione.
| Compound Name | 4-amino-8-benzyl-2-benzylsulfanyl-5H-pteridine-6,7-dione |
|---|---|
| PubChem CID | 25269044 |
| Molecular Formula | C20H17N5O2S |
| Molecular Weight | 391.46 g/mol |
| Exact Mass | 391.11 |
| IUPAC Name | 4-amino-8-benzyl-2-benzylsulfanyl-5H-pteridine-6,7-dione |
| SMILES | Nc1nc(SCc2ccccc2)nc2c1[nH]c(=O)c(=O)n2Cc1ccccc1 |
| InChI | InChI=1S/C20H17N5O2S/c21-16-15-17(24-20(23-16)28-12-14-9-5-2-6-10-14)25(19(27)18(26)22-15)11-13-7-3-1-4-8-13/h1-10H,11-12H2,(H,22,26)(H2,21,23,24) |
| InChIKey | CCQMPJHOMKFSTQ-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 106.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.46 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|