C21H19N5O3S — CID 67263289
methyl 3-[(6-amino-9-benzyl-8-oxo-7H-purin-2-yl)sulfanylmethyl]benzoate (PubChem CID 67263289) has the molecular formula C21H19N5O3S and a molecular weight of 421.48 g/mol. Its IUPAC name is methyl 3-[(6-amino-9-benzyl-8-oxo-7H-purin-2-yl)sulfanylmethyl]benzoate.
| Compound Name | methyl 3-[(6-amino-9-benzyl-8-oxo-7H-purin-2-yl)sulfanylmethyl]benzoate |
|---|---|
| PubChem CID | 67263289 |
| Molecular Formula | C21H19N5O3S |
| Molecular Weight | 421.48 g/mol |
| Exact Mass | 421.12 |
| IUPAC Name | methyl 3-[(6-amino-9-benzyl-8-oxo-7H-purin-2-yl)sulfanylmethyl]benzoate |
| SMILES | COC(=O)c1cccc(CSc2nc(N)c3[nH]c(=O)n(Cc4ccccc4)c3n2)c1 |
| InChI | InChI=1S/C21H19N5O3S/c1-29-19(27)15-9-5-8-14(10-15)12-30-20-24-17(22)16-18(25-20)26(21(28)23-16)11-13-6-3-2-4-7-13/h2-10H,11-12H2,1H3,(H,23,28)(H2,22,24,25) |
| InChIKey | YCZZWONLQPMTFV-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 115.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.48 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |