C17H19N5O3S — CID 18332722
6-amino-9-benzyl-2-[2-(1,3-dioxolan-2-yl)ethylsulfanyl]-7H-purin-8-one (PubChem CID 18332722) has the molecular formula C17H19N5O3S and a molecular weight of 373.44 g/mol. Its IUPAC name is 6-amino-9-benzyl-2-[2-(1,3-dioxolan-2-yl)ethylsulfanyl]-7H-purin-8-one.
| Compound Name | 6-amino-9-benzyl-2-[2-(1,3-dioxolan-2-yl)ethylsulfanyl]-7H-purin-8-one |
|---|---|
| PubChem CID | 18332722 |
| Molecular Formula | C17H19N5O3S |
| Molecular Weight | 373.44 g/mol |
| Exact Mass | 373.12 |
| IUPAC Name | 6-amino-9-benzyl-2-[2-(1,3-dioxolan-2-yl)ethylsulfanyl]-7H-purin-8-one |
| SMILES | Nc1nc(SCCC2OCCO2)nc2c1[nH]c(=O)n2Cc1ccccc1 |
| InChI | InChI=1S/C17H19N5O3S/c18-14-13-15(21-16(20-14)26-9-6-12-24-7-8-25-12)22(17(23)19-13)10-11-4-2-1-3-5-11/h1-5,12H,6-10H2,(H,19,23)(H2,18,20,21) |
| InChIKey | OEOJUVGFWMZPGL-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 108.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.44 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |