C14H15N5OS2 — CID 18332763
6-amino-9-benzyl-2-(methylsulfanylmethylsulfanyl)-7H-purin-8-one (PubChem CID 18332763) has the molecular formula C14H15N5OS2 and a molecular weight of 333.44 g/mol. Its IUPAC name is 6-amino-9-benzyl-2-(methylsulfanylmethylsulfanyl)-7H-purin-8-one.
| Compound Name | 6-amino-9-benzyl-2-(methylsulfanylmethylsulfanyl)-7H-purin-8-one |
|---|---|
| PubChem CID | 18332763 |
| Molecular Formula | C14H15N5OS2 |
| Molecular Weight | 333.44 g/mol |
| Exact Mass | 333.07 |
| IUPAC Name | 6-amino-9-benzyl-2-(methylsulfanylmethylsulfanyl)-7H-purin-8-one |
| SMILES | CSCSc1nc(N)c2[nH]c(=O)n(Cc3ccccc3)c2n1 |
| InChI | InChI=1S/C14H15N5OS2/c1-21-8-22-13-17-11(15)10-12(18-13)19(14(20)16-10)7-9-5-3-2-4-6-9/h2-6H,7-8H2,1H3,(H,16,20)(H2,15,17,18) |
| InChIKey | KQLIJLXHFDQDGZ-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 89.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.44 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|