C16H17N5O4S — CID 59382598
2-[3-[[6-amino-2-(2-hydroxyethylsulfanyl)-8-oxo-7H-purin-9-yl]methyl]phenyl]acetic acid (PubChem CID 59382598) has the molecular formula C16H17N5O4S and a molecular weight of 375.41 g/mol. Its IUPAC name is 2-[3-[[6-amino-2-(2-hydroxyethylsulfanyl)-8-oxo-7H-purin-9-yl]methyl]phenyl]acetic acid.
| Compound Name | 2-[3-[[6-amino-2-(2-hydroxyethylsulfanyl)-8-oxo-7H-purin-9-yl]methyl]phenyl]acetic acid |
|---|---|
| PubChem CID | 59382598 |
| Molecular Formula | C16H17N5O4S |
| Molecular Weight | 375.41 g/mol |
| Exact Mass | 375.10 |
| IUPAC Name | 2-[3-[[6-amino-2-(2-hydroxyethylsulfanyl)-8-oxo-7H-purin-9-yl]methyl]phenyl]acetic acid |
| SMILES | Nc1nc(SCCO)nc2c1[nH]c(=O)n2Cc1cccc(CC(=O)O)c1 |
| InChI | InChI=1S/C16H17N5O4S/c17-13-12-14(20-15(19-13)26-5-4-22)21(16(25)18-12)8-10-3-1-2-9(6-10)7-11(23)24/h1-3,6,22H,4-5,7-8H2,(H,18,25)(H,23,24)(H2,17,19,20) |
| InChIKey | MGAMOZREWNWSOY-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 147.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.41 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |