C12H12N6OS — CID 122671795
6-amino-2-methylsulfanyl-9-(pyridin-3-ylmethyl)-7H-purin-8-one (PubChem CID 122671795) has the molecular formula C12H12N6OS and a molecular weight of 288.34 g/mol. Its IUPAC name is 6-amino-2-methylsulfanyl-9-(pyridin-3-ylmethyl)-7H-purin-8-one.
| Compound Name | 6-amino-2-methylsulfanyl-9-(pyridin-3-ylmethyl)-7H-purin-8-one |
|---|---|
| PubChem CID | 122671795 |
| Molecular Formula | C12H12N6OS |
| Molecular Weight | 288.34 g/mol |
| Exact Mass | 288.08 |
| IUPAC Name | 6-amino-2-methylsulfanyl-9-(pyridin-3-ylmethyl)-7H-purin-8-one |
| SMILES | CSc1nc(N)c2[nH]c(=O)n(Cc3cccnc3)c2n1 |
| InChI | InChI=1S/C12H12N6OS/c1-20-11-16-9(13)8-10(17-11)18(12(19)15-8)6-7-3-2-4-14-5-7/h2-5H,6H2,1H3,(H,15,19)(H2,13,16,17) |
| InChIKey | OWHOVQKHZCNMAL-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 102.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.34 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |