C17H21N5O — CID 58083258
4-amino-6-pentyl-1-(pyridin-3-ylmethyl)-3H-imidazo[4,5-c]pyridin-2-one (PubChem CID 58083258) has the molecular formula C17H21N5O and a molecular weight of 311.39 g/mol. Its IUPAC name is 4-amino-6-pentyl-1-(pyridin-3-ylmethyl)-3H-imidazo[4,5-c]pyridin-2-one.
| Compound Name | 4-amino-6-pentyl-1-(pyridin-3-ylmethyl)-3H-imidazo[4,5-c]pyridin-2-one |
|---|---|
| PubChem CID | 58083258 |
| Molecular Formula | C17H21N5O |
| Molecular Weight | 311.39 g/mol |
| Exact Mass | 311.17 |
| IUPAC Name | 4-amino-6-pentyl-1-(pyridin-3-ylmethyl)-3H-imidazo[4,5-c]pyridin-2-one |
| SMILES | CCCCCc1cc2c([nH]c(=O)n2Cc2cccnc2)c(N)n1 |
| InChI | InChI=1S/C17H21N5O/c1-2-3-4-7-13-9-14-15(16(18)20-13)21-17(23)22(14)11-12-6-5-8-19-10-12/h5-6,8-10H,2-4,7,11H2,1H3,(H2,18,20)(H,21,23) |
| InChIKey | RGRWANQWDMIRFQ-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 89.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.39 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|