C14H14N6O2 — CID 11977603
6-amino-9-benzyl-N-methyl-8-oxo-7H-purine-2-carboxamide (PubChem CID 11977603) has the molecular formula C14H14N6O2 and a molecular weight of 298.31 g/mol. Its IUPAC name is 6-amino-9-benzyl-N-methyl-8-oxo-7H-purine-2-carboxamide.
| Compound Name | 6-amino-9-benzyl-N-methyl-8-oxo-7H-purine-2-carboxamide |
|---|---|
| PubChem CID | 11977603 |
| Molecular Formula | C14H14N6O2 |
| Molecular Weight | 298.31 g/mol |
| Exact Mass | 298.12 |
| IUPAC Name | 6-amino-9-benzyl-N-methyl-8-oxo-7H-purine-2-carboxamide |
| SMILES | CNC(=O)c1nc(N)c2[nH]c(=O)n(Cc3ccccc3)c2n1 |
| InChI | InChI=1S/C14H14N6O2/c1-16-13(21)11-18-10(15)9-12(19-11)20(14(22)17-9)7-8-5-3-2-4-6-8/h2-6H,7H2,1H3,(H,16,21)(H,17,22)(H2,15,18,19) |
| InChIKey | ZXGKWLUAXSFNQW-UHFFFAOYSA-N |
| XLogP | 0.11 |
| TPSA | 118.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.31 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |