C15H18N6O4S — CID 172865035
N-(6-amino-9-benzyl-8-oxo-7H-purin-2-yl)-2-methoxyethanesulfonamide (PubChem CID 172865035) has the molecular formula C15H18N6O4S and a molecular weight of 378.41 g/mol. Its IUPAC name is N-(6-amino-9-benzyl-8-oxo-7H-purin-2-yl)-2-methoxyethanesulfonamide.
| Compound Name | N-(6-amino-9-benzyl-8-oxo-7H-purin-2-yl)-2-methoxyethanesulfonamide |
|---|---|
| PubChem CID | 172865035 |
| Molecular Formula | C15H18N6O4S |
| Molecular Weight | 378.41 g/mol |
| Exact Mass | 378.11 |
| IUPAC Name | N-(6-amino-9-benzyl-8-oxo-7H-purin-2-yl)-2-methoxyethanesulfonamide |
| SMILES | COCCS(=O)(=O)Nc1nc(N)c2[nH]c(=O)n(Cc3ccccc3)c2n1 |
| InChI | InChI=1S/C15H18N6O4S/c1-25-7-8-26(23,24)20-14-18-12(16)11-13(19-14)21(15(22)17-11)9-10-5-3-2-4-6-10/h2-6H,7-9H2,1H3,(H,17,22)(H3,16,18,19,20) |
| InChIKey | ZWIAPAKNGCZFHO-UHFFFAOYSA-N |
| XLogP | 0.14 |
| TPSA | 144.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.41 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |