C15H18N6O3S — CID 163407800
6-amino-9-benzyl-2-(2-methoxyethylsulfonimidoyl)-7H-purin-8-one (PubChem CID 163407800) has the molecular formula C15H18N6O3S and a molecular weight of 362.42 g/mol. Its IUPAC name is 6-amino-9-benzyl-2-(2-methoxyethylsulfonimidoyl)-7H-purin-8-one.
| Compound Name | 6-amino-9-benzyl-2-(2-methoxyethylsulfonimidoyl)-7H-purin-8-one |
|---|---|
| PubChem CID | 163407800 |
| Molecular Formula | C15H18N6O3S |
| Molecular Weight | 362.42 g/mol |
| Exact Mass | 362.12 |
| IUPAC Name | 6-amino-9-benzyl-2-(2-methoxyethylsulfonimidoyl)-7H-purin-8-one |
| SMILES | [H]N=[S@](=O)(CCOC)c1nc(N)c2[nH]c(=O)n(Cc3ccccc3)c2n1 |
| InChI | InChI=1S/C15H18N6O3S/c1-24-7-8-25(17,23)14-19-12(16)11-13(20-14)21(15(22)18-11)9-10-5-3-2-4-6-10/h2-6,17H,7-9H2,1H3,(H,18,22)(H2,16,19,20)/t25-/m0/s1 |
| InChIKey | XVAXOGSGLHCPMT-VWLOTQADSA-N |
| XLogP | 0.80 |
| TPSA | 139.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.42 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |