C18H21N5O6S — CID 174478542
ethyl 4-[(6-amino-9-benzyl-8-oxo-7H-purin-2-yl)sulfonyloxy]butanoate (PubChem CID 174478542) has the molecular formula C18H21N5O6S and a molecular weight of 435.46 g/mol. Its IUPAC name is ethyl 4-[(6-amino-9-benzyl-8-oxo-7H-purin-2-yl)sulfonyloxy]butanoate.
| Compound Name | ethyl 4-[(6-amino-9-benzyl-8-oxo-7H-purin-2-yl)sulfonyloxy]butanoate |
|---|---|
| PubChem CID | 174478542 |
| Molecular Formula | C18H21N5O6S |
| Molecular Weight | 435.46 g/mol |
| Exact Mass | 435.12 |
| IUPAC Name | ethyl 4-[(6-amino-9-benzyl-8-oxo-7H-purin-2-yl)sulfonyloxy]butanoate |
| SMILES | CCOC(=O)CCCOS(=O)(=O)c1nc(N)c2[nH]c(=O)n(Cc3ccccc3)c2n1 |
| InChI | InChI=1S/C18H21N5O6S/c1-2-28-13(24)9-6-10-29-30(26,27)17-21-15(19)14-16(22-17)23(18(25)20-14)11-12-7-4-3-5-8-12/h3-5,7-8H,2,6,9-11H2,1H3,(H,20,25)(H2,19,21,22) |
| InChIKey | XKNZBNPJHYAMDE-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 159.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.46 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|