C13H14N6O3S — CID 175036793
6-amino-9-benzyl-N-methyl-8-oxo-7H-purine-2-sulfonamide (PubChem CID 175036793) has the molecular formula C13H14N6O3S and a molecular weight of 334.36 g/mol. Its IUPAC name is 6-amino-9-benzyl-N-methyl-8-oxo-7H-purine-2-sulfonamide.
| Compound Name | 6-amino-9-benzyl-N-methyl-8-oxo-7H-purine-2-sulfonamide |
|---|---|
| PubChem CID | 175036793 |
| Molecular Formula | C13H14N6O3S |
| Molecular Weight | 334.36 g/mol |
| Exact Mass | 334.08 |
| IUPAC Name | 6-amino-9-benzyl-N-methyl-8-oxo-7H-purine-2-sulfonamide |
| SMILES | CNS(=O)(=O)c1nc(N)c2[nH]c(=O)n(Cc3ccccc3)c2n1 |
| InChI | InChI=1S/C13H14N6O3S/c1-15-23(21,22)12-17-10(14)9-11(18-12)19(13(20)16-9)7-8-5-3-2-4-6-8/h2-6,15H,7H2,1H3,(H,16,20)(H2,14,17,18) |
| InChIKey | IIGKCJKDPXWDAW-UHFFFAOYSA-N |
| XLogP | -0.34 |
| TPSA | 135.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.36 |
| LogP ≤ 5 | -0.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |