C15H11F3N4O2 — CID 52934199
5-amino-1-benzyl-7-(trifluoromethyl)-4H-pyrido[3,4-b]pyrazine-2,3-dione (PubChem CID 52934199) has the molecular formula C15H11F3N4O2 and a molecular weight of 336.27 g/mol. Its IUPAC name is 5-amino-1-benzyl-7-(trifluoromethyl)-4H-pyrido[3,4-b]pyrazine-2,3-dione.
| Compound Name | 5-amino-1-benzyl-7-(trifluoromethyl)-4H-pyrido[3,4-b]pyrazine-2,3-dione |
|---|---|
| PubChem CID | 52934199 |
| Molecular Formula | C15H11F3N4O2 |
| Molecular Weight | 336.27 g/mol |
| Exact Mass | 336.08 |
| IUPAC Name | 5-amino-1-benzyl-7-(trifluoromethyl)-4H-pyrido[3,4-b]pyrazine-2,3-dione |
| SMILES | Nc1nc(C(F)(F)F)cc2c1[nH]c(=O)c(=O)n2Cc1ccccc1 |
| InChI | InChI=1S/C15H11F3N4O2/c16-15(17,18)10-6-9-11(12(19)20-10)21-13(23)14(24)22(9)7-8-4-2-1-3-5-8/h1-6H,7H2,(H2,19,20)(H,21,23) |
| InChIKey | QBKKTOSZSHHEFF-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 93.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.27 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|