C12H8Cl2FN5O — CID 162767091
2-amino-6-chloro-9-[(3-chloro-4-fluorophenyl)methyl]-7H-purin-8-one (PubChem CID 162767091) has the molecular formula C12H8Cl2FN5O and a molecular weight of 328.13 g/mol. Its IUPAC name is 2-amino-6-chloro-9-[(3-chloro-4-fluorophenyl)methyl]-7H-purin-8-one.
| Compound Name | 2-amino-6-chloro-9-[(3-chloro-4-fluorophenyl)methyl]-7H-purin-8-one |
|---|---|
| PubChem CID | 162767091 |
| Molecular Formula | C12H8Cl2FN5O |
| Molecular Weight | 328.13 g/mol |
| Exact Mass | 327.01 |
| IUPAC Name | 2-amino-6-chloro-9-[(3-chloro-4-fluorophenyl)methyl]-7H-purin-8-one |
| SMILES | Nc1nc(Cl)c2[nH]c(=O)n(Cc3ccc(F)c(Cl)c3)c2n1 |
| InChI | InChI=1S/C12H8Cl2FN5O/c13-6-3-5(1-2-7(6)15)4-20-10-8(17-12(20)21)9(14)18-11(16)19-10/h1-3H,4H2,(H,17,21)(H2,16,18,19) |
| InChIKey | JVLVYHXAZQKASV-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 89.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.13 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |