C15H16Cl2N6OS — CID 139454761
6-amino-9-[(3,4-dichlorophenyl)methyl]-2-(propylsulfinimidoyl)-7H-purin-8-one (PubChem CID 139454761) has the molecular formula C15H16Cl2N6OS and a molecular weight of 399.31 g/mol. Its IUPAC name is 6-amino-9-[(3,4-dichlorophenyl)methyl]-2-(propylsulfinimidoyl)-7H-purin-8-one.
| Compound Name | 6-amino-9-[(3,4-dichlorophenyl)methyl]-2-(propylsulfinimidoyl)-7H-purin-8-one |
|---|---|
| PubChem CID | 139454761 |
| Molecular Formula | C15H16Cl2N6OS |
| Molecular Weight | 399.31 g/mol |
| Exact Mass | 398.05 |
| IUPAC Name | 6-amino-9-[(3,4-dichlorophenyl)methyl]-2-(propylsulfinimidoyl)-7H-purin-8-one |
| SMILES | [H]/N=S(\CCC)c1nc(N)c2[nH]c(=O)n(Cc3ccc(Cl)c(Cl)c3)c2n1 |
| InChI | InChI=1S/C15H16Cl2N6OS/c1-2-5-25(19)14-21-12(18)11-13(22-14)23(15(24)20-11)7-8-3-4-9(16)10(17)6-8/h3-4,6,19H,2,5,7H2,1H3,(H,20,24)(H2,18,21,22) |
| InChIKey | PYYAWZJNKIRXGX-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 113.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.31 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |