C16H17F3N6OS — CID 145185571
6-amino-2-(propylsulfinimidoyl)-9-[[4-(trifluoromethyl)phenyl]methyl]-7H-purin-8-one (PubChem CID 145185571) has the molecular formula C16H17F3N6OS and a molecular weight of 398.41 g/mol. Its IUPAC name is 6-amino-2-(propylsulfinimidoyl)-9-[[4-(trifluoromethyl)phenyl]methyl]-7H-purin-8-one.
| Compound Name | 6-amino-2-(propylsulfinimidoyl)-9-[[4-(trifluoromethyl)phenyl]methyl]-7H-purin-8-one |
|---|---|
| PubChem CID | 145185571 |
| Molecular Formula | C16H17F3N6OS |
| Molecular Weight | 398.41 g/mol |
| Exact Mass | 398.11 |
| IUPAC Name | 6-amino-2-(propylsulfinimidoyl)-9-[[4-(trifluoromethyl)phenyl]methyl]-7H-purin-8-one |
| SMILES | [H]/N=S(\CCC)c1nc(N)c2[nH]c(=O)n(Cc3ccc(C(F)(F)F)cc3)c2n1 |
| InChI | InChI=1S/C16H17F3N6OS/c1-2-7-27(21)14-23-12(20)11-13(24-14)25(15(26)22-11)8-9-3-5-10(6-4-9)16(17,18)19/h3-6,21H,2,7-8H2,1H3,(H,22,26)(H2,20,23,24) |
| InChIKey | IXCUJXMAQCHYPN-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 113.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.41 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |