C17H20ClN5O2S — CID 122671734
9-[(4-chlorophenyl)methyl]-6-(ethylamino)-2-propylsulfinyl-7H-purin-8-one (PubChem CID 122671734) has the molecular formula C17H20ClN5O2S and a molecular weight of 393.90 g/mol. Its IUPAC name is 9-[(4-chlorophenyl)methyl]-6-(ethylamino)-2-propylsulfinyl-7H-purin-8-one.
| Compound Name | 9-[(4-chlorophenyl)methyl]-6-(ethylamino)-2-propylsulfinyl-7H-purin-8-one |
|---|---|
| PubChem CID | 122671734 |
| Molecular Formula | C17H20ClN5O2S |
| Molecular Weight | 393.90 g/mol |
| Exact Mass | 393.10 |
| IUPAC Name | 9-[(4-chlorophenyl)methyl]-6-(ethylamino)-2-propylsulfinyl-7H-purin-8-one |
| SMILES | CCCS(=O)c1nc(NCC)c2[nH]c(=O)n(Cc3ccc(Cl)cc3)c2n1 |
| InChI | InChI=1S/C17H20ClN5O2S/c1-3-9-26(25)16-21-14(19-4-2)13-15(22-16)23(17(24)20-13)10-11-5-7-12(18)8-6-11/h5-8H,3-4,9-10H2,1-2H3,(H,20,24)(H,19,21,22) |
| InChIKey | NVMDIWOICAPQTA-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 92.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.90 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |