C18H23N5O2S — CID 122671954
9-benzyl-6-(propylamino)-2-propylsulfinyl-7H-purin-8-one (PubChem CID 122671954) has the molecular formula C18H23N5O2S and a molecular weight of 373.48 g/mol. Its IUPAC name is 9-benzyl-6-(propylamino)-2-propylsulfinyl-7H-purin-8-one.
| Compound Name | 9-benzyl-6-(propylamino)-2-propylsulfinyl-7H-purin-8-one |
|---|---|
| PubChem CID | 122671954 |
| Molecular Formula | C18H23N5O2S |
| Molecular Weight | 373.48 g/mol |
| Exact Mass | 373.16 |
| IUPAC Name | 9-benzyl-6-(propylamino)-2-propylsulfinyl-7H-purin-8-one |
| SMILES | CCCNc1nc(S(=O)CCC)nc2c1[nH]c(=O)n2Cc1ccccc1 |
| InChI | InChI=1S/C18H23N5O2S/c1-3-10-19-15-14-16(22-17(21-15)26(25)11-4-2)23(18(24)20-14)12-13-8-6-5-7-9-13/h5-9H,3-4,10-12H2,1-2H3,(H,20,24)(H,19,21,22) |
| InChIKey | OWUFMTCUOJNOCA-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 92.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.48 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |