C18H21N5OS — CID 122671875
9-benzyl-6-(cyclopropylamino)-2-propylsulfanyl-7H-purin-8-one (PubChem CID 122671875) has the molecular formula C18H21N5OS and a molecular weight of 355.47 g/mol. Its IUPAC name is 9-benzyl-6-(cyclopropylamino)-2-propylsulfanyl-7H-purin-8-one.
| Compound Name | 9-benzyl-6-(cyclopropylamino)-2-propylsulfanyl-7H-purin-8-one |
|---|---|
| PubChem CID | 122671875 |
| Molecular Formula | C18H21N5OS |
| Molecular Weight | 355.47 g/mol |
| Exact Mass | 355.15 |
| IUPAC Name | 9-benzyl-6-(cyclopropylamino)-2-propylsulfanyl-7H-purin-8-one |
| SMILES | CCCSc1nc(NC2CC2)c2[nH]c(=O)n(Cc3ccccc3)c2n1 |
| InChI | InChI=1S/C18H21N5OS/c1-2-10-25-17-21-15(19-13-8-9-13)14-16(22-17)23(18(24)20-14)11-12-6-4-3-5-7-12/h3-7,13H,2,8-11H2,1H3,(H,20,24)(H,19,21,22) |
| InChIKey | IFWBZWHYVNRMMC-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 75.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.47 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |