C17H22N6O2S — CID 122671877
6-(ethylamino)-9-[(6-methyl-3-pyridinyl)methyl]-2-propylsulfinyl-7H-purin-8-one (PubChem CID 122671877) has the molecular formula C17H22N6O2S and a molecular weight of 374.47 g/mol. Its IUPAC name is 6-(ethylamino)-9-[(6-methyl-3-pyridinyl)methyl]-2-propylsulfinyl-7H-purin-8-one.
| Compound Name | 6-(ethylamino)-9-[(6-methyl-3-pyridinyl)methyl]-2-propylsulfinyl-7H-purin-8-one |
|---|---|
| PubChem CID | 122671877 |
| Molecular Formula | C17H22N6O2S |
| Molecular Weight | 374.47 g/mol |
| Exact Mass | 374.15 |
| IUPAC Name | 6-(ethylamino)-9-[(6-methyl-3-pyridinyl)methyl]-2-propylsulfinyl-7H-purin-8-one |
| SMILES | CCCS(=O)c1nc(NCC)c2[nH]c(=O)n(Cc3ccc(C)nc3)c2n1 |
| InChI | InChI=1S/C17H22N6O2S/c1-4-8-26(25)16-21-14(18-5-2)13-15(22-16)23(17(24)20-13)10-12-7-6-11(3)19-9-12/h6-7,9H,4-5,8,10H2,1-3H3,(H,20,24)(H,18,21,22) |
| InChIKey | AOIPJFRADPKAFS-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 105.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.47 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |