C23H30ClN5O3S — CID 122671711
N-[9-[(4-chlorophenyl)methyl]-8-oxo-2-propylsulfinyl-7H-purin-6-yl]-2-propylpentanamide (PubChem CID 122671711) has the molecular formula C23H30ClN5O3S and a molecular weight of 492.05 g/mol. Its IUPAC name is N-[9-[(4-chlorophenyl)methyl]-8-oxo-2-propylsulfinyl-7H-purin-6-yl]-2-propylpentanamide.
| Compound Name | N-[9-[(4-chlorophenyl)methyl]-8-oxo-2-propylsulfinyl-7H-purin-6-yl]-2-propylpentanamide |
|---|---|
| PubChem CID | 122671711 |
| Molecular Formula | C23H30ClN5O3S |
| Molecular Weight | 492.05 g/mol |
| Exact Mass | 491.18 |
| IUPAC Name | N-[9-[(4-chlorophenyl)methyl]-8-oxo-2-propylsulfinyl-7H-purin-6-yl]-2-propylpentanamide |
| SMILES | CCCC(CCC)C(=O)Nc1nc(S(=O)CCC)nc2c1[nH]c(=O)n2Cc1ccc(Cl)cc1 |
| InChI | InChI=1S/C23H30ClN5O3S/c1-4-7-16(8-5-2)21(30)26-19-18-20(28-22(27-19)33(32)13-6-3)29(23(31)25-18)14-15-9-11-17(24)12-10-15/h9-12,16H,4-8,13-14H2,1-3H3,(H,25,31)(H,26,27,28,30) |
| InChIKey | TYOKNHSCNCBJSB-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 109.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.05 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |