C7H8ClN5O2 — CID 86696631
2-amino-6-chloro-9-(2-hydroxyethyl)-7H-purin-8-one (PubChem CID 86696631) has the molecular formula C7H8ClN5O2 and a molecular weight of 229.63 g/mol. Its IUPAC name is 2-amino-6-chloro-9-(2-hydroxyethyl)-7H-purin-8-one.
| Compound Name | 2-amino-6-chloro-9-(2-hydroxyethyl)-7H-purin-8-one |
|---|---|
| PubChem CID | 86696631 |
| Molecular Formula | C7H8ClN5O2 |
| Molecular Weight | 229.63 g/mol |
| Exact Mass | 229.04 |
| IUPAC Name | 2-amino-6-chloro-9-(2-hydroxyethyl)-7H-purin-8-one |
| SMILES | Nc1nc(Cl)c2[nH]c(=O)n(CCO)c2n1 |
| InChI | InChI=1S/C7H8ClN5O2/c8-4-3-5(12-6(9)11-4)13(1-2-14)7(15)10-3/h14H,1-2H2,(H,10,15)(H2,9,11,12) |
| InChIKey | RMNQUPWCXJDXND-UHFFFAOYSA-N |
| XLogP | -0.65 |
| TPSA | 109.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.63 |
| LogP ≤ 5 | -0.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |