C8H10ClN5O — CID 11379172
6-amino-2-chloro-9-propyl-7H-purin-8-one (PubChem CID 11379172) has the molecular formula C8H10ClN5O and a molecular weight of 227.65 g/mol. Its IUPAC name is 6-amino-2-chloro-9-propyl-7H-purin-8-one.
| Compound Name | 6-amino-2-chloro-9-propyl-7H-purin-8-one |
|---|---|
| PubChem CID | 11379172 |
| Molecular Formula | C8H10ClN5O |
| Molecular Weight | 227.65 g/mol |
| Exact Mass | 227.06 |
| IUPAC Name | 6-amino-2-chloro-9-propyl-7H-purin-8-one |
| SMILES | CCCn1c(=O)[nH]c2c(N)nc(Cl)nc21 |
| InChI | InChI=1S/C8H10ClN5O/c1-2-3-14-6-4(11-8(14)15)5(10)12-7(9)13-6/h2-3H2,1H3,(H,11,15)(H2,10,12,13) |
| InChIKey | KWKNRJGRDLCYKZ-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 89.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.65 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |